Metoclopramide Hydrochloride
Catalog No: FT-0672375
CAS No: 7232-21-5
- Chemical Name: Metoclopramide Hydrochloride
- Molecular Formula: C14H23Cl2N3O2
- Molecular Weight: 336.3
- InChI Key: RVFUNJWWXKCWNS-UHFFFAOYSA-N
- InChI: InChI=1S/C14H22ClN3O2.ClH/c1-4-18(5-2)7-6-17-14(19)10-8-11(15)12(16)9-13(10)20-3;/h8-9H,4-7,16H2,1-3H3,(H,17,19);1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 336.25700 |
| Density: | N/A |
| CAS: | 7232-21-5 |
| Bolling_Point: | 418.7ºC at 760 mmHg |
| Product_Name: | 4-Amino-5-chloro-N-(2-(diethylamino)ethyl)-2-methoxybenzamide hydrochloride |
| Melting_Point: | 145ºC |
| Flash_Point: | 207ºC |
| MF: | C14H23Cl2N3O2 |
| LogP: | 3.77650 |
|---|---|
| Flash_Point: | 207ºC |
| Melting_Point: | 145ºC |
| FW: | 336.25700 |
| PSA: | 67.59000 |
| MF: | C14H23Cl2N3O2 |
| Bolling_Point: | 418.7ºC at 760 mmHg |
| Exact_Mass: | 335.11700 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| RTECS: | BZ3325000 |
| Risk_Statements(EU): | R22 |
| Safety_Statements: | 26-36 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn: Harmful; |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)